Phase Equilibria
Study of the equilibrium between different phases of matter and the transitions between them.
Phase
A homogeneous part of a system that is physically distinct and mechanically separable.
| System | Phase | Component | Description |
|---|---|---|---|
| Mixture of O₂, N₂, H₂ gases | 1 | 3 | Gases well mixed; no visible boundary |
| Oil + water (unmixed) | 2 | 2 | Boundary between two liquids |
| Alcohol + water (mixed) | 1 | 2 | No boundary; miscible |
| Salt solution | 1 | 2 | Salt + water |
| Saturated CuSO₄ in closed bottle | 3 | 2 | Solid, liquid, gas (water vapour) |
| Steel | 1 | 2 | Fe + C |
O
O=C=O
[Cu+2].[O-]S(=O)(=O)[O-]
Phase Rule (Gibbs Phase Rule)
$$F = C - P + 2$$
Where:
- F = degrees of freedom
- C = number of components
- P = number of phases
One-Component Phase Diagrams
Water Phase Diagram
- Triple point: All three phases coexist (0.01°C, 0.006 atm)
- Critical point: 374°C, 218 atm (above: supercritical fluid)
- Normal boiling point: 100°C at 1 atm
- Normal freezing point: 0°C at 1 atm
CO₂ Phase Diagram
- Triple point: 5.11 atm, −56.6°C
- Critical point: 31.1°C, 73 atm
- Sublimes at 1 atm (dry ice)
- Solid-liquid line has positive slope (solid denser than liquid)
O=C=O
O
Phase Transitions
| Transition | Name | ΔH |
|---|---|---|
| Solid → Liquid | Fusion (melting) | ΔHfus > 0 |
| Liquid → Solid | Freezing | ΔHfus < 0 |
| Liquid → Gas | Vaporization | ΔHvap > 0 |
| Gas → Liquid | Condensation | ΔHvap < 0 |
| Solid → Gas | Sublimation | ΔHsub > 0 |
| Gas → Solid | Deposition | ΔHsub < 0 |
Clausius-Clapeyron Equation
Describes the temperature dependence of vapor pressure:
$$\ln\frac{P_2}{P_1} = -\frac{\Delta H_{vap}}{R}\left(\frac{1}{T_2} - \frac{1}{T_1}\right)$$
Raoult's Law
For a component A in solution: $$P_A = X_A P_A^o$$
Where:
- $X_A$ = mole fraction of component A
- $P_A^o$ = vapor pressure of pure component A
For a two-component system (A + B), by Dalton's law: $$P_{total} = P_A + P_B = X_A P_A^o + X_B P_B^o$$
Where $X_A + X_B = 1$.
Ideal Solutions
- A–A ≈ B–B ≈ A–B interactions
- $ΔH_{soln} = 0$ (thermoneutral)
- $ΔV = 0$
- Obeys Raoult's law exactly
- Example: benzene–toluene
c1ccccc1
Cc1ccccc1
Deviations from Raoult's Law
| Deviation | Condition | $ΔH_{soln}$ | $ΔV$ | Vapor Pressure | Boiling Point |
|---|---|---|---|---|---|
| Positive | A–A, B–B > A–B | +ve (endothermic) | +ve (expansion) | $P_{actual} > P_{calc}$ | Azeotrope has minimum bp |
| Negative | A–B > A–A, B–B | −ve (exothermic) | −ve (shrinkage) | $P_{actual} < P_{calc}$ | Azeotrope has maximum bp |
- Positive deviation examples: ethanol–water, ethanol–benzene, NaCl–H₂O (ionic)
- Negative deviation examples: HCl–water, HNO₃–water, acetone–chloroform
CCO
c1ccccc1
Cl
O
CC(=O)C
C(Cl)(Cl)Cl
O=[N+]([O-])O
Colligative Properties
Properties that depend on the number of solute particles, not their identity.
1. Vapor Pressure Lowering
$$ΔP = X_{solute} × P°_{solvent}$$
2. Boiling Point Elevation
$$ΔT_b = K_b × m$$
3. Freezing Point Depression
$$ΔT_f = K_f × m$$
4. Osmotic Pressure
$$π = MRT$$
[!example] Worked Examples
Vapor pressure lowering: 218 g glucose (RMM 180.2) in 460 mL water at 30°C. $P°_{water} = 31.82$ mmHg. $X_{glucose} = 0.0453$ → $ΔP = 1.44$ mmHg → $P_{solution} = 30.38$ mmHg.
Freezing point depression: 1.60 g naphthalene (C₁₀H₈) in 20.0 g benzene. $K_f = 4.3$ °C m⁻¹. Pure benzene fp = 5.5°C. $m = 0.624$ mol/kg → $ΔT_f = 2.68$°C → fp = 2.82°C.
Boiling point elevation: 651 g ethylene glycol in 2505 g water. RMM = 62. $K_b = 0.52$ °C/m. $m = 4.19$ mol/kg → $ΔT_b = 2.18$°C → bp = 102.18°C.
Osmotic pressure: 46.0 g glycerin (C₃H₈O₃, RMM 92) per liter at 0°C. $Π = (0.5 / 1.0) × 0.0821 × 273 = 11.21$ atm.
C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O
c1ccc2ccccc2c1
OCCO
OCC(O)CO
Fractional Distillation & Azeotropes
Fractional Distillation
Procedure for separating liquid components based on different boiling points.
- Distillate (receiving flask): lower boiling point component
- Residue (distilling flask): higher boiling point component
Azeotrope
A mixture that distills at constant composition; cannot be separated by simple fractional distillation.
Positive Deviation Azeotropes (Minimum Boiling Point)
| System | Azeotrope Composition | Boiling Point |
|---|---|---|
| Ethanol–Benzene | 32.4% ethanol | Lower than both pure components |
| Ethanol–Water | 95.6% ethanol, 4.4% water | 78.2°C |
- Starting < azeotrope % → distillate = azeotrope, residue = higher bp component
- Starting > azeotrope % → distillate = azeotrope, residue = higher bp component
- Starting = azeotrope → only azeotrope distills over
Negative Deviation Azeotropes (Maximum Boiling Point)
| System | Azeotrope Composition | Boiling Point |
|---|---|---|
| HCl–Water | 20.2% HCl | Higher than both pure components |
| HNO₃–Water | 68% HNO₃, 32% water | 120.5°C |
- Starting < azeotrope % → distillate = lower bp pure component, residue = azeotrope
- Starting > azeotrope % → distillate = higher bp pure component, residue = azeotrope
CCO
CCCCO
Cl
O=[N+]([O-])O
Related Topics
- Thermochemistry — Enthalpy of phase transitions
- Chemical Equilibrium — Phase equilibrium as dynamic process
Sources
- FAD1018 W5-W6 — Phase Equilibria
- FAD1018 - Basic Chemistry II